C24H24N6O3 — CID 176873135
N-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]acetamide (PubChem CID 176873135) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]acetamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 176873135 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[8-isocyano-1-[(2R,4R)-2-methyloxan-4-yl]imidazo[4,5-c]quinolin-2-yl]acetamide |
| SMILES | [C-]#[N+]c1ccc2ncc3nc(CC(=O)Nc4c(C)noc4C)n([C@@H]4CCO[C@H](C)C4)c3c2c1 |
| InChI | InChI=1S/C24H24N6O3/c1-13-9-17(7-8-32-13)30-21(11-22(31)28-23-14(2)29-33-15(23)3)27-20-12-26-19-6-5-16(25-4)10-18(19)24(20)30/h5-6,10,12-13,17H,7-9,11H2,1-3H3,(H,28,31)/t13-,17-/m1/s1 |
| InChIKey | CLZFLVZWAVHOGT-CXAGYDPISA-N |
| XLogP | 4.66 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|