C12H19N3O — CID 176873225
[3-(2-methylpropyl)azetidin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 176873225) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is [3-(2-methylpropyl)azetidin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [3-(2-methylpropyl)azetidin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 176873225 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [3-(2-methylpropyl)azetidin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | CC(C)CC1CN(C(=O)c2cnn(C)c2)C1 |
| InChI | InChI=1S/C12H19N3O/c1-9(2)4-10-6-15(7-10)12(16)11-5-13-14(3)8-11/h5,8-10H,4,6-7H2,1-3H3 |
| InChIKey | UNDHGNVYRQJWOR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |