C12H20F4O4S — CID 176875288
1,1,2,2-tetrafluoro-5-(1-methylcyclohexyl)oxypentane-1-sulfonic acid (PubChem CID 176875288) has the molecular formula C12H20F4O4S and a molecular weight of 336.35 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-5-(1-methylcyclohexyl)oxypentane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-5-(1-methylcyclohexyl)oxypentane-1-sulfonic acid |
|---|---|
| PubChem CID | 176875288 |
| Molecular Formula | C12H20F4O4S |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1,1,2,2-tetrafluoro-5-(1-methylcyclohexyl)oxypentane-1-sulfonic acid |
| SMILES | CC1(OCCCC(F)(F)C(F)(F)S(=O)(=O)O)CCCCC1 |
| InChI | InChI=1S/C12H20F4O4S/c1-10(6-3-2-4-7-10)20-9-5-8-11(13,14)12(15,16)21(17,18)19/h2-9H2,1H3,(H,17,18,19) |
| InChIKey | TXRFVCCAQXWKHP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|