C9H14F4O6S — CID 176875306
1,1,2,2-tetrafluoro-4-[(2-methyl-1,3-dioxolan-2-yl)methoxy]butane-1-sulfonic acid (PubChem CID 176875306) has the molecular formula C9H14F4O6S and a molecular weight of 326.26 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[(2-methyl-1,3-dioxolan-2-yl)methoxy]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[(2-methyl-1,3-dioxolan-2-yl)methoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 176875306 |
| Molecular Formula | C9H14F4O6S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[(2-methyl-1,3-dioxolan-2-yl)methoxy]butane-1-sulfonic acid |
| SMILES | CC1(COCCC(F)(F)C(F)(F)S(=O)(=O)O)OCCO1 |
| InChI | InChI=1S/C9H14F4O6S/c1-7(18-4-5-19-7)6-17-3-2-8(10,11)9(12,13)20(14,15)16/h2-6H2,1H3,(H,14,15,16) |
| InChIKey | CTKQDOALUIJAOK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|