C14H16F7O9S- — CID 176875368
4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(oxolane-2-carbonyloxy)propan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 176875368) has the molecular formula C14H16F7O9S- and a molecular weight of 493.33 g/mol. Its IUPAC name is 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(oxolane-2-carbonyloxy)propan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(oxolane-2-carbonyloxy)propan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 176875368 |
| Molecular Formula | C14H16F7O9S- |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(oxolane-2-carbonyloxy)propan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(OC(=O)C1CCCO1)C(F)(F)F |
| InChI | InChI=1S/C14H17F7O9S/c1-2-27-10(23)12(13(17,18)19,30-9(22)8-4-3-6-28-8)29-7-5-11(15,16)14(20,21)31(24,25)26/h8H,2-7H2,1H3,(H,24,25,26)/p-1 |
| InChIKey | BCQATIWAOWOGFH-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|