About 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate
3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate (PubChem CID 176876236) has the molecular formula C22H21F6NO2
and a molecular weight of 445.40 g/mol. Its IUPAC name is 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate.
Molecular Properties
| Compound Name | 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate |
| PubChem CID | 176876236 |
| Molecular Formula | C22H21F6NO2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate |
| SMILES | CC(C)CCOC(=O)/C(C#N)=C1/C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C22H21F6NO2/c1-13(2)6-7-31-20(30)19(12-29)15-5-3-4-14(8-15)16-9-17(21(23,24)25)11-18(10-16)22(26,27)28/h8-11,13H,3-7H2,1-2H3/b19-15+ |
| InChIKey | FSAGCCDTXZSPGF-XDJHFCHBSA-N |
| XLogP | 6.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate?
The IUPAC name of 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate (CID 176876236) is 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate.
What is the SMILES notation for 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate?
The canonical SMILES for 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate is CC(C)CCOC(=O)/C(C#N)=C1/C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCC1.
What is the InChIKey of 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate?
The InChIKey is FSAGCCDTXZSPGF-XDJHFCHBSA-N. The full InChI is InChI=1S/C22H21F6NO2/c1-13(2)6-7-31-20(30)19(12-29)15-5-3-4-14(8-15)16-9-17(21(23,24)25)11-18(10-16)22(26,27)28/h8-11,13H,3-7H2,1-2H3/b19-15+.
What are the key properties of 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate?
3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate has a molecular weight of 445.40 g/mol, XLogP of 6.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl (2E)-2-[3-[3,5-bis(trifluoromethyl)phenyl]cyclohex-2-en-1-ylidene]-2-cyanoacetate is sourced from PubChem (CID 176876236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).