C48H46N20 — CID 176876845
1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(5-methylimidazol-1-yl)pyrene-1,3,6,8-tetramine (PubChem CID 176876845) has the molecular formula C48H46N20 and a molecular weight of 903.04 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(5-methylimidazol-1-yl)pyrene-1,3,6,8-tetramine.
| Compound Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(5-methylimidazol-1-yl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 176876845 |
| Molecular Formula | C48H46N20 |
| Molecular Weight | 903.04 g/mol |
| Exact Mass | 902.42 |
| IUPAC Name | 1-N,1-N,3-N,3-N,6-N,6-N,8-N,8-N-octakis(5-methylimidazol-1-yl)pyrene-1,3,6,8-tetramine |
| SMILES | Cc1cncn1N(c1cc(N(n2cncc2C)n2cncc2C)c2ccc3c(N(n4cncc4C)n4cncc4C)cc(N(n4cncc4C)n4cncc4C)c4ccc1c2c43)n1cncc1C |
| InChI | InChI=1S/C48H46N20/c1-31-15-49-23-57(31)65(58-24-50-16-32(58)2)43-13-44(66(59-25-51-17-33(59)3)60-26-52-18-34(60)4)40-11-12-42-46(68(63-29-55-21-37(63)7)64-30-56-22-38(64)8)14-45(41-10-9-39(43)47(40)48(41)42)67(61-27-53-19-35(61)5)62-28-54-20-36(62)6/h9-30H,1-8H3 |
| InChIKey | NPOUICNOMXCFRI-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 155.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.04 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|