C63H46N2 — CID 176878064
9,9-dimethyl-N-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(9-phenylcarbazol-4-yl)phenyl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 176878064) has the molecular formula C63H46N2 and a molecular weight of 836.11 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(9-phenylcarbazol-4-yl)phenyl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(9-phenylcarbazol-4-yl)phenyl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 176878064 |
| Molecular Formula | C63H46N2 |
| Molecular Weight | 836.11 g/mol |
| Exact Mass | 835.40 |
| IUPAC Name | 9,9-dimethyl-N-[4-[3-(2,3,4,5,6-pentadeuteriophenyl)-5-(9-phenylcarbazol-4-yl)phenyl]phenyl]-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)cc(-c3cccc4c3c3ccccc3n4-c3ccccc3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C63H46N2/c1-63(2)58-26-14-12-23-55(58)56-38-37-53(42-59(56)63)64(51-33-29-45(30-34-51)43-17-6-3-7-18-43)52-35-31-46(32-36-52)48-39-47(44-19-8-4-9-20-44)40-49(41-48)54-25-16-28-61-62(54)57-24-13-15-27-60(57)65(61)50-21-10-5-11-22-50/h3-42H,1-2H3/i4D,8D,9D,19D,20D |
| InChIKey | XDFYSYRHSAOZKU-IMISQKDISA-N |
| XLogP | 17.23 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.11 |
| LogP ≤ 5 | 17.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |