About 2-(methoxymethyl)oxane-2,4-diol
2-(methoxymethyl)oxane-2,4-diol (PubChem CID 176878463) has the molecular formula C7H14O4
and a molecular weight of 162.18 g/mol. Its IUPAC name is 2-(methoxymethyl)oxane-2,4-diol.
Molecular Properties
| Compound Name | 2-(methoxymethyl)oxane-2,4-diol |
| PubChem CID | 176878463 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-(methoxymethyl)oxane-2,4-diol |
| SMILES | COCC1(O)CC(O)CCO1 |
| InChI | InChI=1S/C7H14O4/c1-10-5-7(9)4-6(8)2-3-11-7/h6,8-9H,2-5H2,1H3 |
| InChIKey | OHTCAUCBYMRQLU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)oxane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)oxane-2,4-diol?
The IUPAC name of 2-(methoxymethyl)oxane-2,4-diol (CID 176878463) is 2-(methoxymethyl)oxane-2,4-diol.
What is the SMILES notation for 2-(methoxymethyl)oxane-2,4-diol?
The canonical SMILES for 2-(methoxymethyl)oxane-2,4-diol is COCC1(O)CC(O)CCO1.
What is the InChIKey of 2-(methoxymethyl)oxane-2,4-diol?
The InChIKey is OHTCAUCBYMRQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4/c1-10-5-7(9)4-6(8)2-3-11-7/h6,8-9H,2-5H2,1H3.
What are the key properties of 2-(methoxymethyl)oxane-2,4-diol?
2-(methoxymethyl)oxane-2,4-diol has a molecular weight of 162.18 g/mol, XLogP of -0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)oxane-2,4-diol is sourced from PubChem (CID 176878463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).