C30H33F2N3O6S — CID 176879139
N-[4-[2-(cyclopropylamino)ethoxy]phenyl]sulfonyl-4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluorobenzamide (PubChem CID 176879139) has the molecular formula C30H33F2N3O6S and a molecular weight of 601.67 g/mol. Its IUPAC name is N-[4-[2-(cyclopropylamino)ethoxy]phenyl]sulfonyl-4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluorobenzamide.
| Compound Name | N-[4-[2-(cyclopropylamino)ethoxy]phenyl]sulfonyl-4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 176879139 |
| Molecular Formula | C30H33F2N3O6S |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | N-[4-[2-(cyclopropylamino)ethoxy]phenyl]sulfonyl-4-[(1R)-1-[5-(cyclopropylmethoxy)-2-pyridinyl]propoxy]-2,3-difluorobenzamide |
| SMILES | CC[C@@H](Oc1ccc(C(=O)NS(=O)(=O)c2ccc(OCCNC3CC3)cc2)c(F)c1F)c1ccc(OCC2CC2)cn1 |
| InChI | InChI=1S/C30H33F2N3O6S/c1-2-26(25-13-9-22(17-34-25)40-18-19-3-4-19)41-27-14-12-24(28(31)29(27)32)30(36)35-42(37,38)23-10-7-21(8-11-23)39-16-15-33-20-5-6-20/h7-14,17,19-20,26,33H,2-6,15-16,18H2,1H3,(H,35,36)/t26-/m1/s1 |
| InChIKey | WXXJIRWASISJCY-AREMUKBSSA-N |
| XLogP | 4.93 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|