C38H33O8S- — CID 176879614
4-[16-[2-[2-(2-methoxyethoxy)ethoxy]phenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxynaphthalene-1-sulfonate (PubChem CID 176879614) has the molecular formula C38H33O8S- and a molecular weight of 649.74 g/mol. Its IUPAC name is 4-[16-[2-[2-(2-methoxyethoxy)ethoxy]phenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxynaphthalene-1-sulfonate.
| Compound Name | 4-[16-[2-[2-(2-methoxyethoxy)ethoxy]phenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxynaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 176879614 |
| Molecular Formula | C38H33O8S- |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | 4-[16-[2-[2-(2-methoxyethoxy)ethoxy]phenyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]oxynaphthalene-1-sulfonate |
| SMILES | COCCOCCOc1ccccc1C1C2c3ccccc3C(c3ccccc32)C1C(=O)Oc1ccc(S(=O)(=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C38H34O8S/c1-43-20-21-44-22-23-45-31-17-9-8-16-30(31)36-34-26-12-4-6-14-28(26)35(29-15-7-5-13-27(29)34)37(36)38(39)46-32-18-19-33(47(40,41)42)25-11-3-2-10-24(25)32/h2-19,34-37H,20-23H2,1H3,(H,40,41,42)/p-1 |
| InChIKey | RTPLTCLIMBEWPK-UHFFFAOYSA-M |
| XLogP | 6.38 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|