C50H32N18 — CID 176881463
3-N-phenyl-1-N,1-N,3-N,6-N,6-N,8-N,8-N-hepta(pyrazin-2-yl)pyrene-1,3,6,8-tetramine (PubChem CID 176881463) has the molecular formula C50H32N18 and a molecular weight of 884.93 g/mol. Its IUPAC name is 3-N-phenyl-1-N,1-N,3-N,6-N,6-N,8-N,8-N-hepta(pyrazin-2-yl)pyrene-1,3,6,8-tetramine.
| Compound Name | 3-N-phenyl-1-N,1-N,3-N,6-N,6-N,8-N,8-N-hepta(pyrazin-2-yl)pyrene-1,3,6,8-tetramine |
|---|---|
| PubChem CID | 176881463 |
| Molecular Formula | C50H32N18 |
| Molecular Weight | 884.93 g/mol |
| Exact Mass | 884.31 |
| IUPAC Name | 3-N-phenyl-1-N,1-N,3-N,6-N,6-N,8-N,8-N-hepta(pyrazin-2-yl)pyrene-1,3,6,8-tetramine |
| SMILES | c1ccc(N(c2cnccn2)c2cc(N(c3cnccn3)c3cnccn3)c3ccc4c(N(c5cnccn5)c5cnccn5)cc(N(c5cnccn5)c5cnccn5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C50H32N18/c1-2-4-33(5-3-1)65(42-26-51-10-17-58-42)38-24-39(66(43-27-52-11-18-59-43)44-28-53-12-19-60-44)35-8-9-37-41(68(47-31-56-15-22-63-47)48-32-57-16-23-64-48)25-40(36-7-6-34(38)49(35)50(36)37)67(45-29-54-13-20-61-45)46-30-55-14-21-62-46/h1-32H |
| InChIKey | OKKYGVMJCOITDG-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 193.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.93 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|