C23H29N3O3S — CID 176882012
1-(3,5-dimethyl-1-adamantyl)-3-[4-[(E)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]urea (PubChem CID 176882012) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-3-[4-[(E)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]urea.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-3-[4-[(E)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]urea |
|---|---|
| PubChem CID | 176882012 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-3-[4-[(E)-(4-hydroxy-2-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]urea |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)Nc1ccc(/C=C4/SC(=O)NC4O)cc1)(C3)C2 |
| InChI | InChI=1S/C23H29N3O3S/c1-21-8-15-9-22(2,11-21)13-23(10-15,12-21)26-19(28)24-16-5-3-14(4-6-16)7-17-18(27)25-20(29)30-17/h3-7,15,18,27H,8-13H2,1-2H3,(H,25,29)(H2,24,26,28)/b17-7+ |
| InChIKey | ZAJBKGFQHHQVMT-REZTVBANSA-N |
| XLogP | 4.67 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|