About 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine
1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine (PubChem CID 176882078) has the molecular formula C20H26F4N2
and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine.
Molecular Properties
| Compound Name | 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine |
| PubChem CID | 176882078 |
| Molecular Formula | C20H26F4N2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine |
| SMILES | CC1(C)CCC(CN2CCNC(C(F)(F)F)C2)=C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H26F4N2/c1-19(2)8-7-15(17(11-19)14-3-5-16(21)6-4-14)12-26-10-9-25-18(13-26)20(22,23)24/h3-6,18,25H,7-13H2,1-2H3 |
| InChIKey | QFWJQQPCCXTGKL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine?
The IUPAC name of 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine (CID 176882078) is 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine.
What is the SMILES notation for 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine?
The canonical SMILES for 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine is CC1(C)CCC(CN2CCNC(C(F)(F)F)C2)=C(c2ccc(F)cc2)C1.
What is the InChIKey of 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine?
The InChIKey is QFWJQQPCCXTGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F4N2/c1-19(2)8-7-15(17(11-19)14-3-5-16(21)6-4-14)12-26-10-9-25-18(13-26)20(22,23)24/h3-6,18,25H,7-13H2,1-2H3.
What are the key properties of 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine?
1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine has a molecular weight of 370.43 g/mol, XLogP of 4.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(4-fluorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]-3-(trifluoromethyl)piperazine is sourced from PubChem (CID 176882078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).