C20H21N3O4 — CID 176882727
N'-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N-(2-phenylethyl)oxamide (PubChem CID 176882727) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N'-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 176882727 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N'-[(3S)-5-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-N-(2-phenylethyl)oxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)C(=O)NCCc2ccccc2)COc2ccccc21 |
| InChI | InChI=1S/C20H21N3O4/c1-23-16-9-5-6-10-17(16)27-13-15(20(23)26)22-19(25)18(24)21-12-11-14-7-3-2-4-8-14/h2-10,15H,11-13H2,1H3,(H,21,24)(H,22,25)/t15-/m0/s1 |
| InChIKey | JUCRDGWVTBTXEH-HNNXBMFYSA-N |
| XLogP | 0.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|