C19H14FNO6S — CID 176882958
6-[(4-fluorophenyl)methyl]-5,5-dioxobenzo[c][1,2]benzothiazine-2,3,8,9-tetrol (PubChem CID 176882958) has the molecular formula C19H14FNO6S and a molecular weight of 403.39 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-5,5-dioxobenzo[c][1,2]benzothiazine-2,3,8,9-tetrol.
| Compound Name | 6-[(4-fluorophenyl)methyl]-5,5-dioxobenzo[c][1,2]benzothiazine-2,3,8,9-tetrol |
|---|---|
| PubChem CID | 176882958 |
| Molecular Formula | C19H14FNO6S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-5,5-dioxobenzo[c][1,2]benzothiazine-2,3,8,9-tetrol |
| SMILES | O=S1(=O)c2cc(O)c(O)cc2-c2cc(O)c(O)cc2N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FNO6S/c20-11-3-1-10(2-4-11)9-21-14-7-17(24)15(22)5-12(14)13-6-16(23)18(25)8-19(13)28(21,26)27/h1-8,22-25H,9H2 |
| InChIKey | LZRFLXKXKNILEX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|