C24H26FN5O2S — CID 176883151
4-[[2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 176883151) has the molecular formula C24H26FN5O2S and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[[2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176883151 |
| Molecular Formula | C24H26FN5O2S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-[[2-[2-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]-6,7-dihydrothieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2nc(N3CCc4oc(-c5ccc(F)cc5)nc4C3)nc3c2SCC3)CC1 |
| InChI | InChI=1S/C24H26FN5O2S/c25-15-3-1-14(2-4-15)23-27-19-13-30(11-9-20(19)32-23)24-28-18-10-12-33-21(18)22(29-24)26-16-5-7-17(31)8-6-16/h1-4,16-17,31H,5-13H2,(H,26,28,29) |
| InChIKey | FZNURLKHFBNIGN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |