C34H36F2N6O2 — CID 176883392
4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(3R,4S)-1,3,4-trimethylpiperidin-3-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 176883392) has the molecular formula C34H36F2N6O2 and a molecular weight of 598.70 g/mol. Its IUPAC name is 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(3R,4S)-1,3,4-trimethylpiperidin-3-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(3R,4S)-1,3,4-trimethylpiperidin-3-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 176883392 |
| Molecular Formula | C34H36F2N6O2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[[(3R,4S)-1,3,4-trimethylpiperidin-3-yl]methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(OC[C@@]5(C)CN(C)CC[C@@H]5C)nc4c3F)c12 |
| InChI | InChI=1S/C34H36F2N6O2/c1-5-24-27(35)9-6-20-12-23(43)13-25(28(20)24)30-29(36)31-26(14-37-30)32(42-15-21-7-8-22(16-42)38-21)40-33(39-31)44-18-34(3)17-41(4)11-10-19(34)2/h1,6,9,12-14,19,21-22,38,43H,7-8,10-11,15-18H2,2-4H3/t19-,21-,22+,34+/m0/s1 |
| InChIKey | DLRJJDJKARTNIL-CAYGZADISA-N |
| XLogP | 5.11 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|