About ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate
ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate (PubChem CID 176883473) has the molecular formula C13H16ClN3O2
and a molecular weight of 281.74 g/mol. Its IUPAC name is ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate |
| PubChem CID | 176883473 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate |
| SMILES | CCCc1nc(Cl)cc2[nH]c(CC(=O)OCC)nc12 |
| InChI | InChI=1S/C13H16ClN3O2/c1-3-5-8-13-9(6-10(14)15-8)16-11(17-13)7-12(18)19-4-2/h6H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | NKZANKDDUXKNMF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate?
The IUPAC name of ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate (CID 176883473) is ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate.
What is the SMILES notation for ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate?
The canonical SMILES for ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate is CCCc1nc(Cl)cc2[nH]c(CC(=O)OCC)nc12.
What is the InChIKey of ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate?
The InChIKey is NKZANKDDUXKNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O2/c1-3-5-8-13-9(6-10(14)15-8)16-11(17-13)7-12(18)19-4-2/h6H,3-5,7H2,1-2H3,(H,16,17).
What are the key properties of ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate?
ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate has a molecular weight of 281.74 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-chloro-4-propyl-1H-imidazo[4,5-c]pyridin-2-yl)acetate is sourced from PubChem (CID 176883473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).