About 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol
4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol (PubChem CID 176883542) has the molecular formula C9H7BrN4O
and a molecular weight of 267.09 g/mol. Its IUPAC name is 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol |
| PubChem CID | 176883542 |
| Molecular Formula | C9H7BrN4O |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol |
| SMILES | Oc1ccc(-c2nnc(CBr)nn2)cc1 |
| InChI | InChI=1S/C9H7BrN4O/c10-5-8-11-13-9(14-12-8)6-1-3-7(15)4-2-6/h1-4,15H,5H2 |
| InChIKey | TZZHGVFTJMNCRS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol?
The IUPAC name of 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol (CID 176883542) is 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol.
What is the SMILES notation for 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol?
The canonical SMILES for 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol is Oc1ccc(-c2nnc(CBr)nn2)cc1.
What is the InChIKey of 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol?
The InChIKey is TZZHGVFTJMNCRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN4O/c10-5-8-11-13-9(14-12-8)6-1-3-7(15)4-2-6/h1-4,15H,5H2.
What are the key properties of 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol?
4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol has a molecular weight of 267.09 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(bromomethyl)-1,2,4,5-tetrazin-3-yl]phenol is sourced from PubChem (CID 176883542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).