About 1-prop-2-enoylpiperidine-3,5-dicarboxamide
1-prop-2-enoylpiperidine-3,5-dicarboxamide (PubChem CID 176884378) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-prop-2-enoylpiperidine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-prop-2-enoylpiperidine-3,5-dicarboxamide |
| PubChem CID | 176884378 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-prop-2-enoylpiperidine-3,5-dicarboxamide |
| SMILES | C=CC(=O)N1CC(C(N)=O)CC(C(N)=O)C1 |
| InChI | InChI=1S/C10H15N3O3/c1-2-8(14)13-4-6(9(11)15)3-7(5-13)10(12)16/h2,6-7H,1,3-5H2,(H2,11,15)(H2,12,16) |
| InChIKey | SJDLYWGOAVGSQZ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enoylpiperidine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enoylpiperidine-3,5-dicarboxamide?
The IUPAC name of 1-prop-2-enoylpiperidine-3,5-dicarboxamide (CID 176884378) is 1-prop-2-enoylpiperidine-3,5-dicarboxamide.
What is the SMILES notation for 1-prop-2-enoylpiperidine-3,5-dicarboxamide?
The canonical SMILES for 1-prop-2-enoylpiperidine-3,5-dicarboxamide is C=CC(=O)N1CC(C(N)=O)CC(C(N)=O)C1.
What is the InChIKey of 1-prop-2-enoylpiperidine-3,5-dicarboxamide?
The InChIKey is SJDLYWGOAVGSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-2-8(14)13-4-6(9(11)15)3-7(5-13)10(12)16/h2,6-7H,1,3-5H2,(H2,11,15)(H2,12,16).
What are the key properties of 1-prop-2-enoylpiperidine-3,5-dicarboxamide?
1-prop-2-enoylpiperidine-3,5-dicarboxamide has a molecular weight of 225.25 g/mol, XLogP of -1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enoylpiperidine-3,5-dicarboxamide is sourced from PubChem (CID 176884378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).