About 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione
3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione (PubChem CID 176884458) has the molecular formula C10H6S4
and a molecular weight of 254.43 g/mol. Its IUPAC name is 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione.
Molecular Properties
| Compound Name | 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione |
| PubChem CID | 176884458 |
| Molecular Formula | C10H6S4 |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 253.94 |
| IUPAC Name | 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione |
| SMILES | S=C1Cc2cc3c(cc2S1)CC(=S)S3 |
| InChI | InChI=1S/C10H6S4/c11-9-3-5-1-7-6(2-8(5)14-9)4-10(12)13-7/h1-2H,3-4H2 |
| InChIKey | ONTTXDCVMCRVHF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione?
The IUPAC name of 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione (CID 176884458) is 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione.
What is the SMILES notation for 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione?
The canonical SMILES for 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione is S=C1Cc2cc3c(cc2S1)CC(=S)S3.
What is the InChIKey of 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione?
The InChIKey is ONTTXDCVMCRVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6S4/c11-9-3-5-1-7-6(2-8(5)14-9)4-10(12)13-7/h1-2H,3-4H2.
What are the key properties of 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione?
3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione has a molecular weight of 254.43 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydrothieno[2,3-f][1]benzothiole-2,6-dithione is sourced from PubChem (CID 176884458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).