C14H11ClF3N3 — CID 176884695
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-5-amine (PubChem CID 176884695) has the molecular formula C14H11ClF3N3 and a molecular weight of 313.71 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-5-amine.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 176884695 |
| Molecular Formula | C14H11ClF3N3 |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2,3-dihydroindol-5-amine |
| SMILES | Nc1ccc2c(c1)CCN2c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H11ClF3N3/c15-11-6-9(14(16,17)18)7-20-13(11)21-4-3-8-5-10(19)1-2-12(8)21/h1-2,5-7H,3-4,19H2 |
| InChIKey | OWVNAPPTQMYBFP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|