About 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole
2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole (PubChem CID 176885351) has the molecular formula C7H3Cl2N3S
and a molecular weight of 232.10 g/mol. Its IUPAC name is 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole |
| PubChem CID | 176885351 |
| Molecular Formula | C7H3Cl2N3S |
| Molecular Weight | 232.10 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole |
| SMILES | Clc1cc(Cl)c(-c2nncs2)cn1 |
| InChI | InChI=1S/C7H3Cl2N3S/c8-5-1-6(9)10-2-4(5)7-12-11-3-13-7/h1-3H |
| InChIKey | PFDHTTDMSQCNTE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole (CID 176885351) is 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole is Clc1cc(Cl)c(-c2nncs2)cn1.
What is the InChIKey of 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole?
The InChIKey is PFDHTTDMSQCNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N3S/c8-5-1-6(9)10-2-4(5)7-12-11-3-13-7/h1-3H.
What are the key properties of 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole?
2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole has a molecular weight of 232.10 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dichloro-3-pyridinyl)-1,3,4-thiadiazole is sourced from PubChem (CID 176885351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).