C19H23ClN2O4 — CID 176886147
(2S,4R)-2-tert-butyl-2-[(2-chloro-4-ethynylphenyl)methylcarbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 176886147) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is (2S,4R)-2-tert-butyl-2-[(2-chloro-4-ethynylphenyl)methylcarbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-tert-butyl-2-[(2-chloro-4-ethynylphenyl)methylcarbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 176886147 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2S,4R)-2-tert-butyl-2-[(2-chloro-4-ethynylphenyl)methylcarbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | C#Cc1ccc(CNC(=O)[C@@]2(C(C)(C)C)C[C@@H](O)CN2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-5-12-6-7-13(15(20)8-12)10-21-16(24)19(18(2,3)4)9-14(23)11-22(19)17(25)26/h1,6-8,14,23H,9-11H2,2-4H3,(H,21,24)(H,25,26)/t14-,19-/m1/s1 |
| InChIKey | HLTOISCEBRJXDF-AUUYWEPGSA-N |
| XLogP | 2.47 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|