C27H28Cl3N3O7Si — CID 176886305
(2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate (PubChem CID 176886305) has the molecular formula C27H28Cl3N3O7Si and a molecular weight of 640.98 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate |
|---|---|
| PubChem CID | 176886305 |
| Molecular Formula | C27H28Cl3N3O7Si |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(n2c(=O)n3c4c(c(C(=O)Oc5c(Cl)cc(Cl)cc5Cl)ccc42)OCC3)C1=O |
| InChI | InChI=1S/C27H28Cl3N3O7Si/c1-41(2,3)11-10-38-14-32-21(34)7-6-20(25(32)35)33-19-5-4-16(23-22(19)31(27(33)37)8-9-39-23)26(36)40-24-17(29)12-15(28)13-18(24)30/h4-5,12-13,20H,6-11,14H2,1-3H3 |
| InChIKey | MDNFSRZBYIJQHS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 109.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|