C27H29Cl3N4O6Si — CID 176886467
(2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate (PubChem CID 176886467) has the molecular formula C27H29Cl3N4O6Si and a molecular weight of 640.00 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate |
|---|---|
| PubChem CID | 176886467 |
| Molecular Formula | C27H29Cl3N4O6Si |
| Molecular Weight | 640.00 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | (2,4,6-trichlorophenyl) 3-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-2-oxo-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-7-carboxylate |
| SMILES | C[Si](C)(C)CCOCN1C(=O)CCC(n2c(=O)n3c4c(c(C(=O)Oc5c(Cl)cc(Cl)cc5Cl)ccc42)NCC3)C1=O |
| InChI | InChI=1S/C27H29Cl3N4O6Si/c1-41(2,3)11-10-39-14-33-21(35)7-6-20(25(33)36)34-19-5-4-16(22-23(19)32(27(34)38)9-8-31-22)26(37)40-24-17(29)12-15(28)13-18(24)30/h4-5,12-13,20,31H,6-11,14H2,1-3H3 |
| InChIKey | KDBLGAJUEWFCQU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|