C26H28Cl3N3O6Si — CID 176886571
(2,4,6-trichlorophenyl) 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carboxylate (PubChem CID 176886571) has the molecular formula C26H28Cl3N3O6Si and a molecular weight of 612.97 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carboxylate.
| Compound Name | (2,4,6-trichlorophenyl) 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 176886571 |
| Molecular Formula | C26H28Cl3N3O6Si |
| Molecular Weight | 612.97 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | (2,4,6-trichlorophenyl) 1-[2,6-dioxo-1-(2-trimethylsilylethoxymethyl)piperidin-3-yl]-3-methyl-2-oxobenzimidazole-5-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)N(COCC[Si](C)(C)C)C2=O)c2ccc(C(=O)Oc3c(Cl)cc(Cl)cc3Cl)cc21 |
| InChI | InChI=1S/C26H28Cl3N3O6Si/c1-30-21-11-15(25(35)38-23-17(28)12-16(27)13-18(23)29)5-6-19(21)32(26(30)36)20-7-8-22(33)31(24(20)34)14-37-9-10-39(2,3)4/h5-6,11-13,20H,7-10,14H2,1-4H3 |
| InChIKey | MBHBRYCQKFDEHI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 99.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.97 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|