C21H18F2N6O3 — CID 176887259
N-[3-(difluoromethyl)phenyl]-N'-[3-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]carbamimidate (PubChem CID 176887259) has the molecular formula C21H18F2N6O3 and a molecular weight of 440.41 g/mol. Its IUPAC name is N-[3-(difluoromethyl)phenyl]-N'-[3-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]carbamimidate.
| Compound Name | N-[3-(difluoromethyl)phenyl]-N'-[3-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]carbamimidate |
|---|---|
| PubChem CID | 176887259 |
| Molecular Formula | C21H18F2N6O3 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[3-(difluoromethyl)phenyl]-N'-[3-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]carbamimidate |
| SMILES | Cc1noc(C)c1-c1ccc(C[n+]2cc(/N=C(\[O-])Nc3cccc(C(F)F)c3)on2)nc1 |
| InChI | InChI=1S/C21H18F2N6O3/c1-12-19(13(2)31-27-12)15-6-7-17(24-9-15)10-29-11-18(32-28-29)26-21(30)25-16-5-3-4-14(8-16)20(22)23/h3-9,11,20H,10H2,1-2H3,(H-,25,26,28,30) |
| InChIKey | JVZSHAFPQQCDDD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|