C31H46O — CID 176887311
bis[(2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl]methanone (PubChem CID 176887311) has the molecular formula C31H46O and a molecular weight of 434.71 g/mol. Its IUPAC name is bis[(2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl]methanone.
| Compound Name | bis[(2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl]methanone |
|---|---|
| PubChem CID | 176887311 |
| Molecular Formula | C31H46O |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | bis[(2Z,5Z,9Z)-2,6,10-trimethylcyclododeca-2,5,9-trien-1-yl]methanone |
| SMILES | C/C1=C/C/C=C(/C)C(C(=O)C2CC/C(C)=C\CC/C(C)=C\C/C=C\2C)CC/C(C)=C\CC1 |
| InChI | InChI=1S/C31H46O/c1-23-11-7-13-25(3)19-21-29(27(5)17-9-15-23)31(32)30-22-20-26(4)14-8-12-24(2)16-10-18-28(30)6/h13-18,29-30H,7-12,19-22H2,1-6H3/b23-15-,24-16-,25-13-,26-14-,27-17-,28-18- |
| InChIKey | WLEGHXIGFOSSMY-XAGCPRSUSA-N |
| XLogP | 9.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|