C16H8F4N2O — CID 176887404
8-(2,3,4,5-tetrafluorophenyl)quinoline-3-carboxamide (PubChem CID 176887404) has the molecular formula C16H8F4N2O and a molecular weight of 320.25 g/mol. Its IUPAC name is 8-(2,3,4,5-tetrafluorophenyl)quinoline-3-carboxamide.
| Compound Name | 8-(2,3,4,5-tetrafluorophenyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 176887404 |
| Molecular Formula | C16H8F4N2O |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 8-(2,3,4,5-tetrafluorophenyl)quinoline-3-carboxamide |
| SMILES | NC(=O)c1cnc2c(-c3cc(F)c(F)c(F)c3F)cccc2c1 |
| InChI | InChI=1S/C16H8F4N2O/c17-11-5-10(12(18)14(20)13(11)19)9-3-1-2-7-4-8(16(21)23)6-22-15(7)9/h1-6H,(H2,21,23) |
| InChIKey | YFDCJWBTQQIMRC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|