C30H36O3Si3 — CID 176887481
[diphenyl(propan-2-yloxy)silyl]oxy-diphenyl-trimethylsilyloxysilane (PubChem CID 176887481) has the molecular formula C30H36O3Si3 and a molecular weight of 528.87 g/mol. Its IUPAC name is [diphenyl(propan-2-yloxy)silyl]oxy-diphenyl-trimethylsilyloxysilane.
| Compound Name | [diphenyl(propan-2-yloxy)silyl]oxy-diphenyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 176887481 |
| Molecular Formula | C30H36O3Si3 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [diphenyl(propan-2-yloxy)silyl]oxy-diphenyl-trimethylsilyloxysilane |
| SMILES | CC(C)O[Si](O[Si](O[Si](C)(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H36O3Si3/c1-26(2)31-35(27-18-10-6-11-19-27,28-20-12-7-13-21-28)33-36(32-34(3,4)5,29-22-14-8-15-23-29)30-24-16-9-17-25-30/h6-26H,1-5H3 |
| InChIKey | ZADZKSPSKCZNNE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|