About 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine
3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine (PubChem CID 176887630) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine |
| PubChem CID | 176887630 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\SCCN1c1cc(C)ccc1C(C)CC |
| InChI | InChI=1S/C14H20N2S/c1-4-11(3)12-6-5-10(2)9-13(12)16-7-8-17-14(16)15/h5-6,9,11,15H,4,7-8H2,1-3H3/b15-14- |
| InChIKey | QOXYGNJRPHBWIG-PFONDFGASA-N |
| XLogP | 4.00 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine?
The IUPAC name of 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine (CID 176887630) is 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine.
What is the SMILES notation for 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine?
The canonical SMILES for 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine is [H]/N=C1\SCCN1c1cc(C)ccc1C(C)CC.
What is the InChIKey of 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine?
The InChIKey is QOXYGNJRPHBWIG-PFONDFGASA-N. The full InChI is InChI=1S/C14H20N2S/c1-4-11(3)12-6-5-10(2)9-13(12)16-7-8-17-14(16)15/h5-6,9,11,15H,4,7-8H2,1-3H3/b15-14-.
What are the key properties of 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine?
3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine has a molecular weight of 248.39 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-butan-2-yl-5-methylphenyl)-1,3-thiazolidin-2-imine is sourced from PubChem (CID 176887630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).