C15H20N2O — CID 176888040
2-(2-cyclohexylethyl)-7-hydroxypyrrolo[2,3-b]pyridine (PubChem CID 176888040) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-7-hydroxypyrrolo[2,3-b]pyridine.
| Compound Name | 2-(2-cyclohexylethyl)-7-hydroxypyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 176888040 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-(2-cyclohexylethyl)-7-hydroxypyrrolo[2,3-b]pyridine |
| SMILES | On1cccc2cc(CCC3CCCCC3)nc1-2 |
| InChI | InChI=1S/C15H20N2O/c18-17-10-4-7-13-11-14(16-15(13)17)9-8-12-5-2-1-3-6-12/h4,7,10-12,18H,1-3,5-6,8-9H2 |
| InChIKey | OPNQUTSAGAHQLM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|