C24H45N3O9Si2 — CID 176888594
1-propa-1,2-dienyl-3,5-bis(1-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 176888594) has the molecular formula C24H45N3O9Si2 and a molecular weight of 575.81 g/mol. Its IUPAC name is 1-propa-1,2-dienyl-3,5-bis(1-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-propa-1,2-dienyl-3,5-bis(1-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 176888594 |
| Molecular Formula | C24H45N3O9Si2 |
| Molecular Weight | 575.81 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 1-propa-1,2-dienyl-3,5-bis(1-triethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C=Cn1c(=O)n(C(CC)[Si](OCC)(OCC)OCC)c(=O)n(C(CC)[Si](OCC)(OCC)OCC)c1=O |
| InChI | InChI=1S/C24H45N3O9Si2/c1-10-19-25-22(28)26(20(11-2)37(31-13-4,32-14-5)33-15-6)24(30)27(23(25)29)21(12-3)38(34-16-7,35-17-8)36-18-9/h19-21H,1,11-18H2,2-9H3 |
| InChIKey | WSFBXCIHVXJFOJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|