About 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one
3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one (PubChem CID 176888643) has the molecular formula C8H8BrNO2
and a molecular weight of 230.06 g/mol. Its IUPAC name is 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one |
| PubChem CID | 176888643 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one |
| SMILES | CC1CNC(=O)c2c(Br)coc21 |
| InChI | InChI=1S/C8H8BrNO2/c1-4-2-10-8(11)6-5(9)3-12-7(4)6/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | SXUBHIKMUBJMPT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one?
The IUPAC name of 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one (CID 176888643) is 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one.
What is the SMILES notation for 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one?
The canonical SMILES for 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one is CC1CNC(=O)c2c(Br)coc21.
What is the InChIKey of 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one?
The InChIKey is SXUBHIKMUBJMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c1-4-2-10-8(11)6-5(9)3-12-7(4)6/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one?
3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one has a molecular weight of 230.06 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one is sourced from PubChem (CID 176888643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).