C12H23ClN2O2 — CID 176888816
3-aminopropyl-[(4Z)-cyclooct-4-en-1-yl]carbamic acid;hydrochloride (PubChem CID 176888816) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is 3-aminopropyl-[(4Z)-cyclooct-4-en-1-yl]carbamic acid;hydrochloride.
| Compound Name | 3-aminopropyl-[(4Z)-cyclooct-4-en-1-yl]carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 176888816 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-aminopropyl-[(4Z)-cyclooct-4-en-1-yl]carbamic acid;hydrochloride |
| SMILES | Cl.NCCCN(C(=O)O)C1CC/C=C\CCC1 |
| InChI | InChI=1S/C12H22N2O2.ClH/c13-9-6-10-14(12(15)16)11-7-4-2-1-3-5-8-11;/h1-2,11H,3-10,13H2,(H,15,16);1H/b2-1-; |
| InChIKey | RZQKXYDQTGPKJP-ODZAUARKSA-N |
| XLogP | 2.63 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|