About 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine
2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine (PubChem CID 176889482) has the molecular formula C9H11Cl2NO
and a molecular weight of 220.10 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine |
| PubChem CID | 176889482 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine |
| SMILES | CC[C@@H](C)Oc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c1-3-6(2)13-9-8(11)4-7(10)5-12-9/h4-6H,3H2,1-2H3/t6-/m1/s1 |
| InChIKey | QJUKHNHBMOMOFD-ZCFIWIBFSA-N |
| XLogP | 3.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine?
The IUPAC name of 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine (CID 176889482) is 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine.
What is the SMILES notation for 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine?
The canonical SMILES for 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine is CC[C@@H](C)Oc1ncc(Cl)cc1Cl.
What is the InChIKey of 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine?
The InChIKey is QJUKHNHBMOMOFD-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H11Cl2NO/c1-3-6(2)13-9-8(11)4-7(10)5-12-9/h4-6H,3H2,1-2H3/t6-/m1/s1.
What are the key properties of 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine?
2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine has a molecular weight of 220.10 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-butan-2-yl]oxy-3,5-dichloropyridine is sourced from PubChem (CID 176889482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).