C15H24O5 — CID 176889491
methyl (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-3-methyl-6-prop-2-enyloxane-2-carboxylate (PubChem CID 176889491) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-3-methyl-6-prop-2-enyloxane-2-carboxylate.
| Compound Name | methyl (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-3-methyl-6-prop-2-enyloxane-2-carboxylate |
|---|---|
| PubChem CID | 176889491 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-3-methyl-6-prop-2-enyloxane-2-carboxylate |
| SMILES | C=CCC1CC[C@H](C)[C@](CC2OCCO2)(C(=O)OC)O1 |
| InChI | InChI=1S/C15H24O5/c1-4-5-12-7-6-11(2)15(20-12,14(16)17-3)10-13-18-8-9-19-13/h4,11-13H,1,5-10H2,2-3H3/t11-,12?,15+/m0/s1 |
| InChIKey | PPGDIFKTRQBIPD-CPNOVKFWSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|