C16H26O5 — CID 176889578
methyl (2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxane-2-carboxylate (PubChem CID 176889578) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl (2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxane-2-carboxylate.
| Compound Name | methyl (2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxane-2-carboxylate |
|---|---|
| PubChem CID | 176889578 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | methyl (2S,6R)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-prop-2-enyloxane-2-carboxylate |
| SMILES | C=CC[C@H]1CCC[C@](C[C@@H]2COC(C)(C)O2)(C(=O)OC)O1 |
| InChI | InChI=1S/C16H26O5/c1-5-7-12-8-6-9-16(21-12,14(17)18-4)10-13-11-19-15(2,3)20-13/h5,12-13H,1,6-11H2,2-4H3/t12-,13+,16-/m0/s1 |
| InChIKey | DKUPVWRTNSXPOS-ZENOOKHLSA-N |
| XLogP | 2.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|