C16H20FNO2 — CID 176890173
[(3R,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl benzoate (PubChem CID 176890173) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is [(3R,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl benzoate.
| Compound Name | [(3R,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl benzoate |
|---|---|
| PubChem CID | 176890173 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [(3R,8S)-3-(fluoromethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl benzoate |
| SMILES | O=C(OC[C@@]12CCCN1[C@@H](CF)CC2)c1ccccc1 |
| InChI | InChI=1S/C16H20FNO2/c17-11-14-7-9-16(8-4-10-18(14)16)12-20-15(19)13-5-2-1-3-6-13/h1-3,5-6,14H,4,7-12H2/t14-,16+/m1/s1 |
| InChIKey | KJYGSRKTUIPTSR-ZBFHGGJFSA-N |
| XLogP | 2.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |