C22H32FIN2O3 — CID 176890575
tert-butyl 9-[2-[(3-fluoro-4-iodo-2-pyridinyl)oxy]ethyl]-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 176890575) has the molecular formula C22H32FIN2O3 and a molecular weight of 518.41 g/mol. Its IUPAC name is tert-butyl 9-[2-[(3-fluoro-4-iodo-2-pyridinyl)oxy]ethyl]-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-[2-[(3-fluoro-4-iodo-2-pyridinyl)oxy]ethyl]-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 176890575 |
| Molecular Formula | C22H32FIN2O3 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | tert-butyl 9-[2-[(3-fluoro-4-iodo-2-pyridinyl)oxy]ethyl]-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(CCOc3nccc(I)c3F)CC2)CC1 |
| InChI | InChI=1S/C22H32FIN2O3/c1-21(2,3)29-20(27)26-13-10-22(11-14-26)8-4-16(5-9-22)7-15-28-19-18(23)17(24)6-12-25-19/h6,12,16H,4-5,7-11,13-15H2,1-3H3 |
| InChIKey | XFCOXEOAZHXSCT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|