About 6H-chromeno[4,3-b]quinolin-9-ylmethanol
6H-chromeno[4,3-b]quinolin-9-ylmethanol (PubChem CID 176891358) has the molecular formula C17H13NO2
and a molecular weight of 263.30 g/mol. Its IUPAC name is 6H-chromeno[4,3-b]quinolin-9-ylmethanol.
Molecular Properties
| Compound Name | 6H-chromeno[4,3-b]quinolin-9-ylmethanol |
| PubChem CID | 176891358 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 6H-chromeno[4,3-b]quinolin-9-ylmethanol |
| SMILES | OCc1ccc2nc3c(cc2c1)COc1ccccc1-3 |
| InChI | InChI=1S/C17H13NO2/c19-9-11-5-6-15-12(7-11)8-13-10-20-16-4-2-1-3-14(16)17(13)18-15/h1-8,19H,9-10H2 |
| InChIKey | GNHAWNMJIUKWOQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-chromeno[4,3-b]quinolin-9-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-chromeno[4,3-b]quinolin-9-ylmethanol?
The IUPAC name of 6H-chromeno[4,3-b]quinolin-9-ylmethanol (CID 176891358) is 6H-chromeno[4,3-b]quinolin-9-ylmethanol.
What is the SMILES notation for 6H-chromeno[4,3-b]quinolin-9-ylmethanol?
The canonical SMILES for 6H-chromeno[4,3-b]quinolin-9-ylmethanol is OCc1ccc2nc3c(cc2c1)COc1ccccc1-3.
What is the InChIKey of 6H-chromeno[4,3-b]quinolin-9-ylmethanol?
The InChIKey is GNHAWNMJIUKWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2/c19-9-11-5-6-15-12(7-11)8-13-10-20-16-4-2-1-3-14(16)17(13)18-15/h1-8,19H,9-10H2.
What are the key properties of 6H-chromeno[4,3-b]quinolin-9-ylmethanol?
6H-chromeno[4,3-b]quinolin-9-ylmethanol has a molecular weight of 263.30 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-chromeno[4,3-b]quinolin-9-ylmethanol is sourced from PubChem (CID 176891358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).