C24H27N3O6 — CID 176891632
5-[(4S)-2,2-dimethyloxan-4-yl]-3-methoxy-1-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]indole-2-carboxylic acid (PubChem CID 176891632) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 5-[(4S)-2,2-dimethyloxan-4-yl]-3-methoxy-1-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]indole-2-carboxylic acid.
| Compound Name | 5-[(4S)-2,2-dimethyloxan-4-yl]-3-methoxy-1-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 176891632 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 5-[(4S)-2,2-dimethyloxan-4-yl]-3-methoxy-1-[(1S,2S)-2-methyl-1-[5-(oxomethylidene)-2H-1,2,4-oxadiazol-3-yl]cyclopropyl]indole-2-carboxylic acid |
| SMILES | COc1c(C(=O)O)n([C@@]2(C3=NC(=C=O)ON3)C[C@@H]2C)c2ccc([C@H]3CCOC(C)(C)C3)cc12 |
| InChI | InChI=1S/C24H27N3O6/c1-13-10-24(13,22-25-18(12-28)33-26-22)27-17-6-5-14(15-7-8-32-23(2,3)11-15)9-16(17)20(31-4)19(27)21(29)30/h5-6,9,13,15H,7-8,10-11H2,1-4H3,(H,25,26)(H,29,30)/t13-,15-,24-/m0/s1 |
| InChIKey | OEPQEDQSGXJFMR-WWDXNRJTSA-N |
| XLogP | 3.36 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|