About ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate
ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate (PubChem CID 176891775) has the molecular formula C10H10N2O3S
and a molecular weight of 238.27 g/mol. Its IUPAC name is ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate |
| PubChem CID | 176891775 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c[n+]([O-])ccc2c1N |
| InChI | InChI=1S/C10H10N2O3S/c1-2-15-10(13)9-8(11)6-3-4-12(14)5-7(6)16-9/h3-5H,2,11H2,1H3 |
| InChIKey | OUJSFLHKDYDTDD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate?
The IUPAC name of ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate (CID 176891775) is ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate.
What is the SMILES notation for ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate?
The canonical SMILES for ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate is CCOC(=O)c1sc2c[n+]([O-])ccc2c1N.
What is the InChIKey of ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate?
The InChIKey is OUJSFLHKDYDTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c1-2-15-10(13)9-8(11)6-3-4-12(14)5-7(6)16-9/h3-5H,2,11H2,1H3.
What are the key properties of ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate?
ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate has a molecular weight of 238.27 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-6-oxidothieno[2,3-c]pyridin-6-ium-2-carboxylate is sourced from PubChem (CID 176891775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).