About 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane]
1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] (PubChem CID 176891896) has the molecular formula C19H18F3NO3S
and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane].
Molecular Properties
| Compound Name | 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] |
| PubChem CID | 176891896 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] |
| SMILES | O=S(=O)(Cc1ccccc1)N1c2ccccc2C2(CCCO2)C1C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO3S/c20-19(21,22)17-18(11-6-12-26-18)15-9-4-5-10-16(15)23(17)27(24,25)13-14-7-2-1-3-8-14/h1-5,7-10,17H,6,11-13H2 |
| InChIKey | WMAKNVBEGKQQEV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane]?
The IUPAC name of 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] (CID 176891896) is 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane].
What is the SMILES notation for 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane]?
The canonical SMILES for 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] is O=S(=O)(Cc1ccccc1)N1c2ccccc2C2(CCCO2)C1C(F)(F)F.
What is the InChIKey of 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane]?
The InChIKey is WMAKNVBEGKQQEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F3NO3S/c20-19(21,22)17-18(11-6-12-26-18)15-9-4-5-10-16(15)23(17)27(24,25)13-14-7-2-1-3-8-14/h1-5,7-10,17H,6,11-13H2.
What are the key properties of 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane]?
1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] has a molecular weight of 397.42 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfonyl-2-(trifluoromethyl)spiro[2H-indole-3,2'-oxolane] is sourced from PubChem (CID 176891896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).