C12H13N3OS2 — CID 176892201
(2R,3S)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 176892201) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is (2R,3S)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R,3S)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 176892201 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (2R,3S)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | Nc1nnc(S[C@H]2Cc3ccccc3C[C@H]2O)s1 |
| InChI | InChI=1S/C12H13N3OS2/c13-11-14-15-12(18-11)17-10-6-8-4-2-1-3-7(8)5-9(10)16/h1-4,9-10,16H,5-6H2,(H2,13,14)/t9-,10+/m1/s1 |
| InChIKey | GZONTICPGSZRKQ-ZJUUUORDSA-N |
| XLogP | 1.74 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |