C20H33Cl2N5O5 — CID 176892291
tert-butyl 3-[2-[2-[2-[4-(4,6-dichloro-1,3,5-triazin-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 176892291) has the molecular formula C20H33Cl2N5O5 and a molecular weight of 494.42 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[4-(4,6-dichloro-1,3,5-triazin-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[4-(4,6-dichloro-1,3,5-triazin-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 176892291 |
| Molecular Formula | C20H33Cl2N5O5 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[4-(4,6-dichloro-1,3,5-triazin-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN1CCN(c2nc(Cl)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C20H33Cl2N5O5/c1-20(2,3)32-16(28)4-10-29-12-14-31-15-13-30-11-9-26-5-7-27(8-6-26)19-24-17(21)23-18(22)25-19/h4-15H2,1-3H3 |
| InChIKey | CYXBMQXAQRRQKE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|