C22H40INO5 — CID 176892403
trimethyl-[4-[[(1S,4S,5R,8S,9R,10R,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]azanium iodide (PubChem CID 176892403) has the molecular formula C22H40INO5 and a molecular weight of 525.47 g/mol. Its IUPAC name is trimethyl-[4-[[(1S,4S,5R,8S,9R,10R,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]azanium iodide.
| Compound Name | trimethyl-[4-[[(1S,4S,5R,8S,9R,10R,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]azanium iodide |
|---|---|
| PubChem CID | 176892403 |
| Molecular Formula | C22H40INO5 |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | trimethyl-[4-[[(1S,4S,5R,8S,9R,10R,12R,13S)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]butyl]azanium iodide |
| SMILES | C[C@H]1[C@H](OCCCC[N+](C)(C)C)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@]24OO3.[I-] |
| InChI | InChI=1S/C22H40NO5.HI/c1-15-9-10-18-16(2)19(24-14-8-7-13-23(4,5)6)25-20-22(18)17(15)11-12-21(3,26-20)27-28-22;/h15-20H,7-14H2,1-6H3;1H/q+1;/p-1/t15-,16-,17+,18+,19-,20-,21+,22+;/m1./s1 |
| InChIKey | LCCCTZJVAIYCLC-VGASWBNDSA-M |
| XLogP | 0.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|