C27H25N3O2 — CID 176892431
4-methyl-N-[(3,10,12-trimethyl-11-oxo-8,12-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-10-yl)methyl]benzamide (PubChem CID 176892431) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-methyl-N-[(3,10,12-trimethyl-11-oxo-8,12-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-10-yl)methyl]benzamide.
| Compound Name | 4-methyl-N-[(3,10,12-trimethyl-11-oxo-8,12-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-10-yl)methyl]benzamide |
|---|---|
| PubChem CID | 176892431 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-methyl-N-[(3,10,12-trimethyl-11-oxo-8,12-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-10-yl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC2(C)C(=O)N(C)c3cccc4c3c2nc2cccc(C)c24)cc1 |
| InChI | InChI=1S/C27H25N3O2/c1-16-11-13-18(14-12-16)25(31)28-15-27(3)24-23-19(8-6-10-21(23)30(4)26(27)32)22-17(2)7-5-9-20(22)29-24/h5-14H,15H2,1-4H3,(H,28,31) |
| InChIKey | VTWJNRBFJRTJSQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|